About [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate
[(E)-pent-2-enyl] N,N-dimethylcarbamodithioate (PubChem CID 24975958) has the molecular formula C8H15NS2
and a molecular weight of 189.35 g/mol. Its IUPAC name is [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate |
| PubChem CID | 24975958 |
| Molecular Formula | C8H15NS2 |
| Molecular Weight | 189.35 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate |
| SMILES | CC/C=C/CSC(=S)N(C)C |
| InChI | InChI=1S/C8H15NS2/c1-4-5-6-7-11-8(10)9(2)3/h5-6H,4,7H2,1-3H3/b6-5+ |
| InChIKey | NGIVCWYXGDVHFZ-AATRIKPKSA-N |
| XLogP | 2.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate?
The IUPAC name of [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate (CID 24975958) is [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate.
What is the SMILES notation for [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate?
The canonical SMILES for [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate is CC/C=C/CSC(=S)N(C)C.
What is the InChIKey of [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate?
The InChIKey is NGIVCWYXGDVHFZ-AATRIKPKSA-N. The full InChI is InChI=1S/C8H15NS2/c1-4-5-6-7-11-8(10)9(2)3/h5-6H,4,7H2,1-3H3/b6-5+.
What are the key properties of [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate?
[(E)-pent-2-enyl] N,N-dimethylcarbamodithioate has a molecular weight of 189.35 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-pent-2-enyl] N,N-dimethylcarbamodithioate is sourced from PubChem (CID 24975958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).