About 2-fluoroundecanoic acid
2-fluoroundecanoic acid (PubChem CID 24976101) has the molecular formula C11H21FO2
and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-fluoroundecanoic acid.
Molecular Properties
| Compound Name | 2-fluoroundecanoic acid |
| PubChem CID | 24976101 |
| Molecular Formula | C11H21FO2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-fluoroundecanoic acid |
| SMILES | CCCCCCCCCC(F)C(=O)O |
| InChI | InChI=1S/C11H21FO2/c1-2-3-4-5-6-7-8-9-10(12)11(13)14/h10H,2-9H2,1H3,(H,13,14) |
| InChIKey | UQXHPNYCPAAXSS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroundecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroundecanoic acid?
The IUPAC name of 2-fluoroundecanoic acid (CID 24976101) is 2-fluoroundecanoic acid.
What is the SMILES notation for 2-fluoroundecanoic acid?
The canonical SMILES for 2-fluoroundecanoic acid is CCCCCCCCCC(F)C(=O)O.
What is the InChIKey of 2-fluoroundecanoic acid?
The InChIKey is UQXHPNYCPAAXSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21FO2/c1-2-3-4-5-6-7-8-9-10(12)11(13)14/h10H,2-9H2,1H3,(H,13,14).
What are the key properties of 2-fluoroundecanoic acid?
2-fluoroundecanoic acid has a molecular weight of 204.28 g/mol, XLogP of 3.55, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroundecanoic acid is sourced from PubChem (CID 24976101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).