C14H16N2O5 — CID 24977249
tert-butyl N-(2,5-dioxo-4-phenyl-1,3-oxazolidin-3-yl)carbamate (PubChem CID 24977249) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is tert-butyl N-(2,5-dioxo-4-phenyl-1,3-oxazolidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(2,5-dioxo-4-phenyl-1,3-oxazolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 24977249 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | tert-butyl N-(2,5-dioxo-4-phenyl-1,3-oxazolidin-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NN1C(=O)OC(=O)C1c1ccccc1 |
| InChI | InChI=1S/C14H16N2O5/c1-14(2,3)21-12(18)15-16-10(11(17)20-13(16)19)9-7-5-4-6-8-9/h4-8,10H,1-3H3,(H,15,18) |
| InChIKey | BVYVVVKMKVSVBF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|