C24H30N4O6 — CID 24978698
N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methyl-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 24978698) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methyl-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methyl-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 24978698 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methyl-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | CCOc1ccc(NC(=O)CN(C)C(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)cc1OCC |
| InChI | InChI=1S/C24H30N4O6/c1-4-33-21-11-9-18(15-22(21)34-5-2)25-23(29)16-26(3)24(30)17-8-10-19(20(14-17)28(31)32)27-12-6-7-13-27/h8-11,14-15H,4-7,12-13,16H2,1-3H3,(H,25,29) |
| InChIKey | RGVKISQZAXLQHQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|