C22H27N3O5S2 — CID 24979011
N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 24979011) has the molecular formula C22H27N3O5S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 24979011 |
| Molecular Formula | C22H27N3O5S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CC1(NC(=O)c2cccc(S(=O)(=O)N3CCN(c4ccccc4)CC3)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H27N3O5S2/c1-22(10-15-31(27,28)17-22)23-21(26)18-6-5-9-20(16-18)32(29,30)25-13-11-24(12-14-25)19-7-3-2-4-8-19/h2-9,16H,10-15,17H2,1H3,(H,23,26) |
| InChIKey | JSHDPNLSWVTNGT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |