C20H26F3N3O4S — CID 24979579
N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 24979579) has the molecular formula C20H26F3N3O4S and a molecular weight of 461.51 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24979579 |
| Molecular Formula | C20H26F3N3O4S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H26F3N3O4S/c21-20(22,23)16-4-1-5-17(14-16)31(29,30)26-12-7-15(8-13-26)19(28)24-9-3-11-25-10-2-6-18(25)27/h1,4-5,14-15H,2-3,6-13H2,(H,24,28) |
| InChIKey | NKACJBILNNWSCH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|