C18H12F2N2O3 — CID 24980602
(3,4-difluorophenyl) 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate (PubChem CID 24980602) has the molecular formula C18H12F2N2O3 and a molecular weight of 342.30 g/mol. Its IUPAC name is (3,4-difluorophenyl) 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate.
| Compound Name | (3,4-difluorophenyl) 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate |
|---|---|
| PubChem CID | 24980602 |
| Molecular Formula | C18H12F2N2O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (3,4-difluorophenyl) 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate |
| SMILES | O=C(Oc1ccc(F)c(F)c1)c1ccc2c(=O)n3c(nc2c1)CCC3 |
| InChI | InChI=1S/C18H12F2N2O3/c19-13-6-4-11(9-14(13)20)25-18(24)10-3-5-12-15(8-10)21-16-2-1-7-22(16)17(12)23/h3-6,8-9H,1-2,7H2 |
| InChIKey | VQFVSOGTDIHLSV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|