C20H17FN2O3S — CID 8525997
2-(2-fluorophenyl)sulfanylethyl 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate (PubChem CID 8525997) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanylethyl 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate.
| Compound Name | 2-(2-fluorophenyl)sulfanylethyl 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate |
|---|---|
| PubChem CID | 8525997 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanylethyl 9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazoline-6-carboxylate |
| SMILES | O=C(OCCSc1ccccc1F)c1ccc2c(=O)n3c(nc2c1)CCC3 |
| InChI | InChI=1S/C20H17FN2O3S/c21-15-4-1-2-5-17(15)27-11-10-26-20(25)13-7-8-14-16(12-13)22-18-6-3-9-23(18)19(14)24/h1-2,4-5,7-8,12H,3,6,9-11H2 |
| InChIKey | WDEQILIOJYFXDK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|