C26H29N3O6S — CID 24982505
N-[2-(2-methoxyanilino)-2-oxoethyl]-3-[(4-methoxyphenyl)sulfamoyl]-N-propylbenzamide (PubChem CID 24982505) has the molecular formula C26H29N3O6S and a molecular weight of 511.60 g/mol. Its IUPAC name is N-[2-(2-methoxyanilino)-2-oxoethyl]-3-[(4-methoxyphenyl)sulfamoyl]-N-propylbenzamide.
| Compound Name | N-[2-(2-methoxyanilino)-2-oxoethyl]-3-[(4-methoxyphenyl)sulfamoyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 24982505 |
| Molecular Formula | C26H29N3O6S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | N-[2-(2-methoxyanilino)-2-oxoethyl]-3-[(4-methoxyphenyl)sulfamoyl]-N-propylbenzamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1OC)C(=O)c1cccc(S(=O)(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C26H29N3O6S/c1-4-16-29(18-25(30)27-23-10-5-6-11-24(23)35-3)26(31)19-8-7-9-22(17-19)36(32,33)28-20-12-14-21(34-2)15-13-20/h5-15,17,28H,4,16,18H2,1-3H3,(H,27,30) |
| InChIKey | NTHJLQYJRPEQPJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |