C15H7ClF4N4O — CID 24983026
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2,3,4,5-tetrafluorobenzamide (PubChem CID 24983026) has the molecular formula C15H7ClF4N4O and a molecular weight of 370.69 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 24983026 |
| Molecular Formula | C15H7ClF4N4O |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1-n1cncn1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H7ClF4N4O/c16-7-1-2-11(24-6-21-5-22-24)10(3-7)23-15(25)8-4-9(17)13(19)14(20)12(8)18/h1-6H,(H,23,25) |
| InChIKey | OURSBARFPQCPAG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|