C15H10ClN5O3 — CID 3818974
N-(3-chlorophenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 3818974) has the molecular formula C15H10ClN5O3 and a molecular weight of 343.73 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(3-chlorophenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 3818974 |
| Molecular Formula | C15H10ClN5O3 |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-(3-chlorophenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10ClN5O3/c16-11-2-1-3-12(7-11)19-15(22)10-4-5-13(14(6-10)21(23)24)20-9-17-8-18-20/h1-9H,(H,19,22) |
| InChIKey | ANOHOYYOKGZTHB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|