C19H17ClN6O3 — CID 24816819
[4-(3-chlorophenyl)piperazin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone (PubChem CID 24816819) has the molecular formula C19H17ClN6O3 and a molecular weight of 412.84 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 24816819 |
| Molecular Formula | C19H17ClN6O3 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-n2cncn2)c([N+](=O)[O-])c1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H17ClN6O3/c20-15-2-1-3-16(11-15)23-6-8-24(9-7-23)19(27)14-4-5-17(18(10-14)26(28)29)25-13-21-12-22-25/h1-5,10-13H,6-9H2 |
| InChIKey | YBOQZPGGYWKXBW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|