C23H24ClN5O5 — CID 24983183
[2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 24983183) has the molecular formula C23H24ClN5O5 and a molecular weight of 485.93 g/mol. Its IUPAC name is [2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 24983183 |
| Molecular Formula | C23H24ClN5O5 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | CC(C)CN(C(=O)COC(=O)c1cccnc1Cl)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H24ClN5O5/c1-14(2)11-28(17(30)13-34-22(32)16-9-6-10-26-19(16)24)18-20(25)29(23(33)27-21(18)31)12-15-7-4-3-5-8-15/h3-10,14H,11-13,25H2,1-2H3,(H,27,31,33) |
| InChIKey | NXDKPSVOHSQSKG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 140.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|