C19H24ClN5O5 — CID 2651030
[2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 2651030) has the molecular formula C19H24ClN5O5 and a molecular weight of 437.88 g/mol. Its IUPAC name is [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2651030 |
| Molecular Formula | C19H24ClN5O5 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | CCCCN(C(=O)COC(=O)c1cccnc1Cl)c1c(N)n(CCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H24ClN5O5/c1-3-5-10-24(14-16(21)25(9-4-2)19(29)23-17(14)27)13(26)11-30-18(28)12-7-6-8-22-15(12)20/h6-8H,3-5,9-11,21H2,1-2H3,(H,23,27,29) |
| InChIKey | XLZZSTHMEANCBE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 140.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|