C6H12O2 — CID 24984
2,6-dimethyl-1,4-dioxane (PubChem CID 24984) has the molecular formula C6H12O2 and a molecular weight of 116.16 g/mol. Its IUPAC name is 2,6-dimethyl-1,4-dioxane.
| Compound Name | 2,6-dimethyl-1,4-dioxane |
|---|---|
| PubChem CID | 24984 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 2,6-dimethyl-1,4-dioxane |
| SMILES | CC1COCC(C)O1 |
| InChI | InChI=1S/C6H12O2/c1-5-3-7-4-6(2)8-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | JZUPYBRYQINNRE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |