C24H23N3O2S — CID 24985454
2-benzyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 24985454) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-benzyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 2-benzyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 24985454 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-benzyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O=S(=O)(c1ccc(-c2ccnc3[nH]c(Cc4ccccc4)cc23)cc1)N1CCCC1 |
| InChI | InChI=1S/C24H23N3O2S/c28-30(29,27-14-4-5-15-27)21-10-8-19(9-11-21)22-12-13-25-24-23(22)17-20(26-24)16-18-6-2-1-3-7-18/h1-3,6-13,17H,4-5,14-16H2,(H,25,26) |
| InChIKey | GUZVHMQXIDPYMG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |