C28H24F3N3O6S — CID 87524415
[2-[3-[[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methoxy]phenyl]acetyl] 2,2,2-trifluoroacetate (PubChem CID 87524415) has the molecular formula C28H24F3N3O6S and a molecular weight of 587.58 g/mol. Its IUPAC name is [2-[3-[[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methoxy]phenyl]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methoxy]phenyl]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87524415 |
| Molecular Formula | C28H24F3N3O6S |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | [2-[3-[[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methoxy]phenyl]acetyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Cc1cccc(OCc2cc3c(-c4ccc(S(=O)(=O)N5CCCC5)cc4)ccnc3[nH]2)c1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C28H24F3N3O6S/c29-28(30,31)27(36)40-25(35)15-18-4-3-5-21(14-18)39-17-20-16-24-23(10-11-32-26(24)33-20)19-6-8-22(9-7-19)41(37,38)34-12-1-2-13-34/h3-11,14,16H,1-2,12-13,15,17H2,(H,32,33) |
| InChIKey | YIFQJUWLRZNYQR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|