C40H57F13O2 — CID 24985842
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridecanoate (PubChem CID 24985842) has the molecular formula C40H57F13O2 and a molecular weight of 816.87 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridecanoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridecanoate |
|---|---|
| PubChem CID | 24985842 |
| Molecular Formula | C40H57F13O2 |
| Molecular Weight | 816.87 g/mol |
| Exact Mass | 816.42 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridecanoate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C40H57F13O2/c1-24(2)11-10-12-25(3)29-16-17-30-28-15-14-26-23-27(18-21-33(26,4)31(28)19-22-34(29,30)5)55-32(54)13-8-6-7-9-20-35(41,42)36(43,44)37(45,46)38(47,48)39(49,50)40(51,52)53/h14,24-25,27-31H,6-13,15-23H2,1-5H3 |
| InChIKey | GNZIKMIOOWVDCA-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.87 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|