C41H60F6O3 — CID 24986004
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[3,5-bis(trifluoromethyl)phenoxy]hexanoate (PubChem CID 24986004) has the molecular formula C41H60F6O3 and a molecular weight of 714.92 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[3,5-bis(trifluoromethyl)phenoxy]hexanoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[3,5-bis(trifluoromethyl)phenoxy]hexanoate |
|---|---|
| PubChem CID | 24986004 |
| Molecular Formula | C41H60F6O3 |
| Molecular Weight | 714.92 g/mol |
| Exact Mass | 714.44 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[3,5-bis(trifluoromethyl)phenoxy]hexanoate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CCC4CC(OC(=O)CCCCCOc5cc(C(F)(F)F)cc(C(F)(F)F)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C41H60F6O3/c1-26(2)10-9-11-27(3)34-15-16-35-33-14-13-28-23-31(17-19-38(28,4)36(33)18-20-39(34,35)5)50-37(48)12-7-6-8-21-49-32-24-29(40(42,43)44)22-30(25-32)41(45,46)47/h22,24-28,31,33-36H,6-21,23H2,1-5H3 |
| InChIKey | RSAQFTVHQQTRIM-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.92 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|