C18H20BrN5O2S — CID 24986332
4-[(6-bromoquinazolin-2-yl)amino]-N-[2-(dimethylamino)ethyl]benzenesulfonamide (PubChem CID 24986332) has the molecular formula C18H20BrN5O2S and a molecular weight of 450.36 g/mol. Its IUPAC name is 4-[(6-bromoquinazolin-2-yl)amino]-N-[2-(dimethylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-[(6-bromoquinazolin-2-yl)amino]-N-[2-(dimethylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24986332 |
| Molecular Formula | C18H20BrN5O2S |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 4-[(6-bromoquinazolin-2-yl)amino]-N-[2-(dimethylamino)ethyl]benzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(Nc2ncc3cc(Br)ccc3n2)cc1 |
| InChI | InChI=1S/C18H20BrN5O2S/c1-24(2)10-9-21-27(25,26)16-6-4-15(5-7-16)22-18-20-12-13-11-14(19)3-8-17(13)23-18/h3-8,11-12,21H,9-10H2,1-2H3,(H,20,22,23) |
| InChIKey | XZGJIZUEBGTNLH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |