C24H27FN8OS — CID 24987668
3-N-[3-fluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 24987668) has the molecular formula C24H27FN8OS and a molecular weight of 494.60 g/mol. Its IUPAC name is 3-N-[3-fluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-fluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 24987668 |
| Molecular Formula | C24H27FN8OS |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 3-N-[3-fluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(OCCN3CCCC3)c(F)c2)nn1-c1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C24H27FN8OS/c25-17-13-15(7-8-18(17)34-12-11-32-9-3-4-10-32)29-24-30-23(26)33(31-24)21-20-16-5-1-2-6-19(16)35-22(20)28-14-27-21/h7-8,13-14H,1-6,9-12H2,(H3,26,29,30,31) |
| InChIKey | ADDYMOHBGKHNLV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |