C23H24N8O — CID 24987674
1-[4-[4-[(5-amino-1-isoquinolin-1-yl-1,2,4-triazol-3-yl)amino]phenyl]piperazin-1-yl]ethanone (PubChem CID 24987674) has the molecular formula C23H24N8O and a molecular weight of 428.50 g/mol. Its IUPAC name is 1-[4-[4-[(5-amino-1-isoquinolin-1-yl-1,2,4-triazol-3-yl)amino]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[(5-amino-1-isoquinolin-1-yl-1,2,4-triazol-3-yl)amino]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 24987674 |
| Molecular Formula | C23H24N8O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-[4-[4-[(5-amino-1-isoquinolin-1-yl-1,2,4-triazol-3-yl)amino]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3nc(N)n(-c4nccc5ccccc45)n3)cc2)CC1 |
| InChI | InChI=1S/C23H24N8O/c1-16(32)29-12-14-30(15-13-29)19-8-6-18(7-9-19)26-23-27-22(24)31(28-23)21-20-5-3-2-4-17(20)10-11-25-21/h2-11H,12-15H2,1H3,(H3,24,26,27,28) |
| InChIKey | ARMLHETXAWWYGX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|