C14H11ClN4O2S — CID 24987948
2-(carbamoylamino)-6-(2-chlorothiophen-3-yl)-1H-indole-3-carboxamide (PubChem CID 24987948) has the molecular formula C14H11ClN4O2S and a molecular weight of 334.79 g/mol. Its IUPAC name is 2-(carbamoylamino)-6-(2-chlorothiophen-3-yl)-1H-indole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-6-(2-chlorothiophen-3-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 24987948 |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-(carbamoylamino)-6-(2-chlorothiophen-3-yl)-1H-indole-3-carboxamide |
| SMILES | NC(=O)Nc1[nH]c2cc(-c3ccsc3Cl)ccc2c1C(N)=O |
| InChI | InChI=1S/C14H11ClN4O2S/c15-11-7(3-4-22-11)6-1-2-8-9(5-6)18-13(19-14(17)21)10(8)12(16)20/h1-5,18H,(H2,16,20)(H3,17,19,21) |
| InChIKey | LTMYIIMREIUNCT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |