C14H12N4O2S — CID 24987947
2-(carbamoylamino)-6-thiophen-3-yl-1H-indole-3-carboxamide (PubChem CID 24987947) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-(carbamoylamino)-6-thiophen-3-yl-1H-indole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-6-thiophen-3-yl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 24987947 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-(carbamoylamino)-6-thiophen-3-yl-1H-indole-3-carboxamide |
| SMILES | NC(=O)Nc1[nH]c2cc(-c3ccsc3)ccc2c1C(N)=O |
| InChI | InChI=1S/C14H12N4O2S/c15-12(19)11-9-2-1-7(8-3-4-21-6-8)5-10(9)17-13(11)18-14(16)20/h1-6,17H,(H2,15,19)(H3,16,18,20) |
| InChIKey | UHCAHVUHHJXABU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |