C27H26F3N3O3 — CID 24989178
8-hydroxy-4-phenyl-3-[1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-1,4-dihydroquinazolin-2-one (PubChem CID 24989178) has the molecular formula C27H26F3N3O3 and a molecular weight of 497.52 g/mol. Its IUPAC name is 8-hydroxy-4-phenyl-3-[1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-1,4-dihydroquinazolin-2-one.
| Compound Name | 8-hydroxy-4-phenyl-3-[1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 24989178 |
| Molecular Formula | C27H26F3N3O3 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 8-hydroxy-4-phenyl-3-[1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-1,4-dihydroquinazolin-2-one |
| SMILES | O=C1Nc2c(O)cccc2C(c2ccccc2)N1C1CCN(Cc2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C27H26F3N3O3/c28-27(29,30)36-21-9-4-6-18(16-21)17-32-14-12-20(13-15-32)33-25(19-7-2-1-3-8-19)22-10-5-11-23(34)24(22)31-26(33)35/h1-11,16,20,25,34H,12-15,17H2,(H,31,35) |
| InChIKey | OUPAHMJEYSSTCR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|