C21H27N2O3S+ — CID 24989492
[1-[3-(methanesulfonamido)phenyl]-2-phenylmethoxyethyl]-dimethyl-prop-2-ynylazanium (PubChem CID 24989492) has the molecular formula C21H27N2O3S+ and a molecular weight of 387.53 g/mol. Its IUPAC name is [1-[3-(methanesulfonamido)phenyl]-2-phenylmethoxyethyl]-dimethyl-prop-2-ynylazanium.
| Compound Name | [1-[3-(methanesulfonamido)phenyl]-2-phenylmethoxyethyl]-dimethyl-prop-2-ynylazanium |
|---|---|
| PubChem CID | 24989492 |
| Molecular Formula | C21H27N2O3S+ |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | [1-[3-(methanesulfonamido)phenyl]-2-phenylmethoxyethyl]-dimethyl-prop-2-ynylazanium |
| SMILES | C#CC[N+](C)(C)C(COCc1ccccc1)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H27N2O3S/c1-5-14-23(2,3)21(17-26-16-18-10-7-6-8-11-18)19-12-9-13-20(15-19)22-27(4,24)25/h1,6-13,15,21-22H,14,16-17H2,2-4H3/q+1 |
| InChIKey | DCTDRQZBRDHBDU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|