C23H30CaN2O5 — CID 24990014
calcium (2S,3aS,6aS)-1-[(2S)-2-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]azanidylpropanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate (PubChem CID 24990014) has the molecular formula C23H30CaN2O5 and a molecular weight of 454.58 g/mol. Its IUPAC name is calcium (2S,3aS,6aS)-1-[(2S)-2-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]azanidylpropanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | calcium (2S,3aS,6aS)-1-[(2S)-2-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]azanidylpropanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 24990014 |
| Molecular Formula | C23H30CaN2O5 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | calcium (2S,3aS,6aS)-1-[(2S)-2-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]azanidylpropanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)[N-][C@@H](C)C(=O)N1[C@H](C(=O)[O-])C[C@@H]2CCC[C@@H]21.[Ca+2] |
| InChI | InChI=1S/C23H31N2O5.Ca/c1-3-30-23(29)18(13-12-16-8-5-4-6-9-16)24-15(2)21(26)25-19-11-7-10-17(19)14-20(25)22(27)28;/h4-6,8-9,15,17-20H,3,7,10-14H2,1-2H3,(H,27,28);/q-1;+2/p-1/t15-,17-,18-,19-,20-;/m0./s1 |
| InChIKey | CFTYMCGPTPWRPS-IKZVEOHFSA-M |
| XLogP | 1.45 |
| TPSA | 100.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |