C18H27N2O3S+ — CID 24990264
but-2-ynyl-[1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enylazanium (PubChem CID 24990264) has the molecular formula C18H27N2O3S+ and a molecular weight of 351.49 g/mol. Its IUPAC name is but-2-ynyl-[1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enylazanium.
| Compound Name | but-2-ynyl-[1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enylazanium |
|---|---|
| PubChem CID | 24990264 |
| Molecular Formula | C18H27N2O3S+ |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | but-2-ynyl-[1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enylazanium |
| SMILES | C=CC[N+](C)(CC#CC)C(COC)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H27N2O3S/c1-6-8-13-20(3,12-7-2)18(15-23-4)16-10-9-11-17(14-16)19-24(5,21)22/h7,9-11,14,18-19H,2,12-13,15H2,1,3-5H3/q+1 |
| InChIKey | BMBAWQMKRSQIOB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|