C17H25ClN2O3S — CID 24989489
[1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enyl-prop-2-ynylazanium chloride (PubChem CID 24989489) has the molecular formula C17H25ClN2O3S and a molecular weight of 372.92 g/mol. Its IUPAC name is [1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enyl-prop-2-ynylazanium chloride.
| Compound Name | [1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enyl-prop-2-ynylazanium chloride |
|---|---|
| PubChem CID | 24989489 |
| Molecular Formula | C17H25ClN2O3S |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enyl-prop-2-ynylazanium chloride |
| SMILES | C#CC[N+](C)(CC=C)C(COC)c1cccc(NS(C)(=O)=O)c1.[Cl-] |
| InChI | InChI=1S/C17H25N2O3S.ClH/c1-6-11-19(3,12-7-2)17(14-22-4)15-9-8-10-16(13-15)18-23(5,20)21;/h1,7-10,13,17-18H,2,11-12,14H2,3-5H3;1H/q+1;/p-1 |
| InChIKey | XEUPZFWHCKITQP-UHFFFAOYSA-M |
| XLogP | -0.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|