C18H27BrN2O3S — CID 24990263
but-2-ynyl-[1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enylazanium bromide (PubChem CID 24990263) has the molecular formula C18H27BrN2O3S and a molecular weight of 431.40 g/mol. Its IUPAC name is but-2-ynyl-[1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enylazanium bromide.
| Compound Name | but-2-ynyl-[1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enylazanium bromide |
|---|---|
| PubChem CID | 24990263 |
| Molecular Formula | C18H27BrN2O3S |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | but-2-ynyl-[1-[3-(methanesulfonamido)phenyl]-2-methoxyethyl]-methyl-prop-2-enylazanium bromide |
| SMILES | C=CC[N+](C)(CC#CC)C(COC)c1cccc(NS(C)(=O)=O)c1.[Br-] |
| InChI | InChI=1S/C18H27N2O3S.BrH/c1-6-8-13-20(3,12-7-2)18(15-23-4)16-10-9-11-17(14-16)19-24(5,21)22;/h7,9-11,14,18-19H,2,12-13,15H2,1,3-5H3;1H/q+1;/p-1 |
| InChIKey | WEGSZFWNENRREO-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|