C26H26Br2N6O4S2 — CID 24992505
(2E)-3-(4-bromo-1H-indol-3-yl)-N-[2-[2-[[(2E)-3-(4-bromo-1H-indol-3-yl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide (PubChem CID 24992505) has the molecular formula C26H26Br2N6O4S2 and a molecular weight of 710.47 g/mol. Its IUPAC name is (2E)-3-(4-bromo-1H-indol-3-yl)-N-[2-[2-[[(2E)-3-(4-bromo-1H-indol-3-yl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide.
| Compound Name | (2E)-3-(4-bromo-1H-indol-3-yl)-N-[2-[2-[[(2E)-3-(4-bromo-1H-indol-3-yl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 24992505 |
| Molecular Formula | C26H26Br2N6O4S2 |
| Molecular Weight | 710.47 g/mol |
| Exact Mass | 707.98 |
| IUPAC Name | (2E)-3-(4-bromo-1H-indol-3-yl)-N-[2-[2-[[(2E)-3-(4-bromo-1H-indol-3-yl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide |
| SMILES | O=C(NCCSSCCNC(=O)/C(Cc1c[nH]c2cccc(Br)c12)=N/O)/C(Cc1c[nH]c2cccc(Br)c12)=N/O |
| InChI | InChI=1S/C26H26Br2N6O4S2/c27-17-3-1-5-19-23(17)15(13-31-19)11-21(33-37)25(35)29-7-9-39-40-10-8-30-26(36)22(34-38)12-16-14-32-20-6-2-4-18(28)24(16)20/h1-6,13-14,31-32,37-38H,7-12H2,(H,29,35)(H,30,36)/b33-21+,34-22+ |
| InChIKey | LQJLLHDIVZIBNO-WXGDAXOSSA-N |
| XLogP | 5.23 |
| TPSA | 154.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|