C19H32N2O3 — CID 24992881
[(2S)-2-(dimethylamino)-4-methylpentyl] 4-amino-3-butoxybenzoate (PubChem CID 24992881) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is [(2S)-2-(dimethylamino)-4-methylpentyl] 4-amino-3-butoxybenzoate.
| Compound Name | [(2S)-2-(dimethylamino)-4-methylpentyl] 4-amino-3-butoxybenzoate |
|---|---|
| PubChem CID | 24992881 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | [(2S)-2-(dimethylamino)-4-methylpentyl] 4-amino-3-butoxybenzoate |
| SMILES | CCCCOc1cc(C(=O)OC[C@H](CC(C)C)N(C)C)ccc1N |
| InChI | InChI=1S/C19H32N2O3/c1-6-7-10-23-18-12-15(8-9-17(18)20)19(22)24-13-16(21(4)5)11-14(2)3/h8-9,12,14,16H,6-7,10-11,13,20H2,1-5H3/t16-/m0/s1 |
| InChIKey | XSKQNQDPPGFROS-INIZCTEOSA-N |
| XLogP | 3.58 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|