C22H36N2O3 — CID 24996997
[(2S)-3-methyl-2-piperidin-1-ylpentyl] 4-amino-3-butoxybenzoate (PubChem CID 24996997) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is [(2S)-3-methyl-2-piperidin-1-ylpentyl] 4-amino-3-butoxybenzoate.
| Compound Name | [(2S)-3-methyl-2-piperidin-1-ylpentyl] 4-amino-3-butoxybenzoate |
|---|---|
| PubChem CID | 24996997 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | [(2S)-3-methyl-2-piperidin-1-ylpentyl] 4-amino-3-butoxybenzoate |
| SMILES | CCCCOc1cc(C(=O)OC[C@H](C(C)CC)N2CCCCC2)ccc1N |
| InChI | InChI=1S/C22H36N2O3/c1-4-6-14-26-21-15-18(10-11-19(21)23)22(25)27-16-20(17(3)5-2)24-12-8-7-9-13-24/h10-11,15,17,20H,4-9,12-14,16,23H2,1-3H3/t17?,20-/m1/s1 |
| InChIKey | ICWNLLULDMCMHC-UUSAFJCLSA-N |
| XLogP | 4.51 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|