C19H30N2O3 — CID 74382696
(3-methyl-2-piperidin-1-ylbutyl) 4-amino-3-ethoxybenzoate (PubChem CID 74382696) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is (3-methyl-2-piperidin-1-ylbutyl) 4-amino-3-ethoxybenzoate.
| Compound Name | (3-methyl-2-piperidin-1-ylbutyl) 4-amino-3-ethoxybenzoate |
|---|---|
| PubChem CID | 74382696 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (3-methyl-2-piperidin-1-ylbutyl) 4-amino-3-ethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(C(C)C)N2CCCCC2)ccc1N |
| InChI | InChI=1S/C19H30N2O3/c1-4-23-18-12-15(8-9-16(18)20)19(22)24-13-17(14(2)3)21-10-6-5-7-11-21/h8-9,12,14,17H,4-7,10-11,13,20H2,1-3H3 |
| InChIKey | FSSVVILCZUUUGJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|