C33H39F4N2O12S3+ — CID 24993403
6-[6-sulfo-2-[(E,3E)-3-[4,5,6,7-tetrafluoro-3-methyl-1,3-bis(4-sulfobutyl)indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium-3-yl]hexanoic acid (PubChem CID 24993403) has the molecular formula C33H39F4N2O12S3+ and a molecular weight of 827.87 g/mol. Its IUPAC name is 6-[6-sulfo-2-[(E,3E)-3-[4,5,6,7-tetrafluoro-3-methyl-1,3-bis(4-sulfobutyl)indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium-3-yl]hexanoic acid.
| Compound Name | 6-[6-sulfo-2-[(E,3E)-3-[4,5,6,7-tetrafluoro-3-methyl-1,3-bis(4-sulfobutyl)indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 24993403 |
| Molecular Formula | C33H39F4N2O12S3+ |
| Molecular Weight | 827.87 g/mol |
| Exact Mass | 827.16 |
| IUPAC Name | 6-[6-sulfo-2-[(E,3E)-3-[4,5,6,7-tetrafluoro-3-methyl-1,3-bis(4-sulfobutyl)indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium-3-yl]hexanoic acid |
| SMILES | CC1(CCCCS(=O)(=O)O)/C(=C\C=C\c2oc3cc(S(=O)(=O)O)ccc3[n+]2CCCCCC(=O)O)N(CCCCS(=O)(=O)O)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C33H38F4N2O12S3/c1-33(15-4-7-18-52(42,43)44)24(39(17-6-8-19-53(45,46)47)32-27(33)28(34)29(35)30(36)31(32)37)10-9-11-25-38(16-5-2-3-12-26(40)41)22-14-13-21(54(48,49)50)20-23(22)51-25/h9-11,13-14,20H,2-8,12,15-19H2,1H3,(H3-,40,41,42,43,44,45,46,47,48,49,50)/p+1 |
| InChIKey | OTWDEJZMECPEMN-UHFFFAOYSA-O |
| XLogP | 5.57 |
| TPSA | 220.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|