C18H16ClFN2O — CID 24994369
2-butyl-3-(4-chlorophenyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one (PubChem CID 24994369) has the molecular formula C18H16ClFN2O and a molecular weight of 330.79 g/mol. Its IUPAC name is 2-butyl-3-(4-chlorophenyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-butyl-3-(4-chlorophenyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 24994369 |
| Molecular Formula | C18H16ClFN2O |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-butyl-3-(4-chlorophenyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCCCc1nc2ccc(F)cn2c(=O)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClFN2O/c1-2-3-4-15-17(12-5-7-13(19)8-6-12)18(23)22-11-14(20)9-10-16(22)21-15/h5-11H,2-4H2,1H3 |
| InChIKey | WJINBXRGUDWNAD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |