C27H47NO6S — CID 25000620
2-[[(2R,4R)-4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoyl]amino]ethanesulfonic acid (PubChem CID 25000620) has the molecular formula C27H47NO6S and a molecular weight of 513.74 g/mol. Its IUPAC name is 2-[[(2R,4R)-4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(2R,4R)-4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 25000620 |
| Molecular Formula | C27H47NO6S |
| Molecular Weight | 513.74 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 2-[[(2R,4R)-4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoyl]amino]ethanesulfonic acid |
| SMILES | C[C@H](C[C@@H](C)[C@H]1CCC2C3C(O)CC4C[C@H](O)CC[C@]4(C)C3CC[C@@]21C)C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C27H47NO6S/c1-16(13-17(2)25(31)28-11-12-35(32,33)34)20-5-6-21-24-22(8-10-27(20,21)4)26(3)9-7-19(29)14-18(26)15-23(24)30/h16-24,29-30H,5-15H2,1-4H3,(H,28,31)(H,32,33,34)/t16-,17-,18?,19-,20-,21?,22?,23?,24?,26+,27-/m1/s1 |
| InChIKey | BQLNYPHEUSQKOD-DYQJSJDWSA-N |
| XLogP | 3.64 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.74 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|