C27H47NO5S — CID 25007813
2-[[(4R)-4-[(3R,10S,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoyl]amino]ethanesulfonic acid (PubChem CID 25007813) has the molecular formula C27H47NO5S and a molecular weight of 497.74 g/mol. Its IUPAC name is 2-[[(4R)-4-[(3R,10S,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(4R)-4-[(3R,10S,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 25007813 |
| Molecular Formula | C27H47NO5S |
| Molecular Weight | 497.74 g/mol |
| Exact Mass | 497.32 |
| IUPAC Name | 2-[[(4R)-4-[(3R,10S,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoyl]amino]ethanesulfonic acid |
| SMILES | CC(C[C@@H](C)[C@H]1CCC2C3CCC4C[C@H](O)CC[C@]4(C)C3CC[C@@]21C)C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C27H47NO5S/c1-17(15-18(2)25(30)28-13-14-34(31,32)33)22-7-8-23-21-6-5-19-16-20(29)9-11-26(19,3)24(21)10-12-27(22,23)4/h17-24,29H,5-16H2,1-4H3,(H,28,30)(H,31,32,33)/t17-,18?,19?,20-,21?,22-,23?,24?,26+,27-/m1/s1 |
| InChIKey | ZNIIKLZZTOKMSP-IHKBXRPZSA-N |
| XLogP | 4.67 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.74 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|