C16H22O5S — CID 25000677
dimethyl (2S)-2-hydroxy-2-[(4-methylphenyl)sulfanylmethyl]hexanedioate (PubChem CID 25000677) has the molecular formula C16H22O5S and a molecular weight of 326.41 g/mol. Its IUPAC name is dimethyl (2S)-2-hydroxy-2-[(4-methylphenyl)sulfanylmethyl]hexanedioate.
| Compound Name | dimethyl (2S)-2-hydroxy-2-[(4-methylphenyl)sulfanylmethyl]hexanedioate |
|---|---|
| PubChem CID | 25000677 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | dimethyl (2S)-2-hydroxy-2-[(4-methylphenyl)sulfanylmethyl]hexanedioate |
| SMILES | COC(=O)CCC[C@@](O)(CSc1ccc(C)cc1)C(=O)OC |
| InChI | InChI=1S/C16H22O5S/c1-12-6-8-13(9-7-12)22-11-16(19,15(18)21-3)10-4-5-14(17)20-2/h6-9,19H,4-5,10-11H2,1-3H3/t16-/m1/s1 |
| InChIKey | NBKXLGCUHLXOCL-MRXNPFEDSA-N |
| XLogP | 2.33 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |