C15H20O6S — CID 10404239
ethyl (5S)-2-hydroxy-5-methyl-3-(4-methylphenyl)sulfonyloxolane-2-carboxylate (PubChem CID 10404239) has the molecular formula C15H20O6S and a molecular weight of 328.39 g/mol. Its IUPAC name is ethyl (5S)-2-hydroxy-5-methyl-3-(4-methylphenyl)sulfonyloxolane-2-carboxylate.
| Compound Name | ethyl (5S)-2-hydroxy-5-methyl-3-(4-methylphenyl)sulfonyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 10404239 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethyl (5S)-2-hydroxy-5-methyl-3-(4-methylphenyl)sulfonyloxolane-2-carboxylate |
| SMILES | CCOC(=O)C1(O)O[C@@H](C)CC1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20O6S/c1-4-20-14(16)15(17)13(9-11(3)21-15)22(18,19)12-7-5-10(2)6-8-12/h5-8,11,13,17H,4,9H2,1-3H3/t11-,13?,15?/m0/s1 |
| InChIKey | GWGXTZLTZNNMLO-ZOODHJKOSA-N |
| XLogP | 1.20 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |