C20H24FN3O3 — CID 25000680
tert-butyl N-[1-[(E)-but-2-enyl]-2-oxopyrimidin-4-yl]-N-[(3-fluorophenyl)methyl]carbamate (PubChem CID 25000680) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is tert-butyl N-[1-[(E)-but-2-enyl]-2-oxopyrimidin-4-yl]-N-[(3-fluorophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[1-[(E)-but-2-enyl]-2-oxopyrimidin-4-yl]-N-[(3-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 25000680 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | tert-butyl N-[1-[(E)-but-2-enyl]-2-oxopyrimidin-4-yl]-N-[(3-fluorophenyl)methyl]carbamate |
| SMILES | C/C=C/Cn1ccc(N(Cc2cccc(F)c2)C(=O)OC(C)(C)C)nc1=O |
| InChI | InChI=1S/C20H24FN3O3/c1-5-6-11-23-12-10-17(22-18(23)25)24(19(26)27-20(2,3)4)14-15-8-7-9-16(21)13-15/h5-10,12-13H,11,14H2,1-4H3/b6-5+ |
| InChIKey | MJKNYFUQZYLKTQ-AATRIKPKSA-N |
| XLogP | 3.90 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|