C33H37F3N4O6 — CID 25002329
ethyl (1R,4R,6S,7Z,15R,17R)-13-methyl-2,14-dioxo-17-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]carbamoyloxy]-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate (PubChem CID 25002329) has the molecular formula C33H37F3N4O6 and a molecular weight of 642.68 g/mol. Its IUPAC name is ethyl (1R,4R,6S,7Z,15R,17R)-13-methyl-2,14-dioxo-17-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]carbamoyloxy]-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1R,4R,6S,7Z,15R,17R)-13-methyl-2,14-dioxo-17-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]carbamoyloxy]-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 25002329 |
| Molecular Formula | C33H37F3N4O6 |
| Molecular Weight | 642.68 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | ethyl (1R,4R,6S,7Z,15R,17R)-13-methyl-2,14-dioxo-17-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]carbamoyloxy]-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1/C=C\CCCCN(C)C(=O)[C@@H]1C[C@H](OC(=O)Nc3cc(C(F)(F)F)ccc3-c3ccccn3)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C33H37F3N4O6/c1-3-45-30(43)32-19-21(32)10-6-4-5-9-15-40(2)29(42)25-18-22(17-24(25)28(41)39-32)46-31(44)38-27-16-20(33(34,35)36)12-13-23(27)26-11-7-8-14-37-26/h6-8,10-14,16,21-22,24-25H,3-5,9,15,17-19H2,1-2H3,(H,38,44)(H,39,41)/b10-6-/t21-,22-,24-,25-,32-/m1/s1 |
| InChIKey | CWZMVDXPHQUZKE-RXGYQGFRSA-N |
| XLogP | 5.35 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|