C26H33N7O3 — CID 25002852
N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-4-[(9-cyclopentyl-5-methyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxybenzamide (PubChem CID 25002852) has the molecular formula C26H33N7O3 and a molecular weight of 491.60 g/mol. Its IUPAC name is N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-4-[(9-cyclopentyl-5-methyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxybenzamide.
| Compound Name | N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-4-[(9-cyclopentyl-5-methyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 25002852 |
| Molecular Formula | C26H33N7O3 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-4-[(9-cyclopentyl-5-methyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC2[C@H]3CNC[C@@H]23)ccc1Nc1ncc2c(n1)N(C1CCCC1)CCC(=O)N2C |
| InChI | InChI=1S/C26H33N7O3/c1-32-20-14-28-26(31-24(20)33(10-9-22(32)34)16-5-3-4-6-16)29-19-8-7-15(11-21(19)36-2)25(35)30-23-17-12-27-13-18(17)23/h7-8,11,14,16-18,23,27H,3-6,9-10,12-13H2,1-2H3,(H,30,35)(H,28,29,31)/t17-,18+,23? |
| InChIKey | VNZQHZXYKSWQRC-NHJWOMDBSA-N |
| XLogP | 2.29 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |