C27H35N7O3 — CID 25003203
4-[(9-cyclopentyl-5-methyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxy-N-[(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]benzamide (PubChem CID 25003203) has the molecular formula C27H35N7O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is 4-[(9-cyclopentyl-5-methyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxy-N-[(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]benzamide.
| Compound Name | 4-[(9-cyclopentyl-5-methyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxy-N-[(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]benzamide |
|---|---|
| PubChem CID | 25003203 |
| Molecular Formula | C27H35N7O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | 4-[(9-cyclopentyl-5-methyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxy-N-[(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]benzamide |
| SMILES | COc1cc(C(=O)NC2[C@H]3CN(C)C[C@@H]23)ccc1Nc1ncc2c(n1)N(C1CCCC1)CCC(=O)N2C |
| InChI | InChI=1S/C27H35N7O3/c1-32-14-18-19(15-32)24(18)30-26(36)16-8-9-20(22(12-16)37-3)29-27-28-13-21-25(31-27)34(17-6-4-5-7-17)11-10-23(35)33(21)2/h8-9,12-13,17-19,24H,4-7,10-11,14-15H2,1-3H3,(H,30,36)(H,28,29,31)/t18-,19+,24? |
| InChIKey | ZUMRVCZPKXRZBO-QRQCMCJISA-N |
| XLogP | 2.63 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |