C22H29F2N2O3+ — CID 25003620
2-(2-methyl-3-propylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate (PubChem CID 25003620) has the molecular formula C22H29F2N2O3+ and a molecular weight of 407.48 g/mol. Its IUPAC name is 2-(2-methyl-3-propylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate.
| Compound Name | 2-(2-methyl-3-propylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 25003620 |
| Molecular Formula | C22H29F2N2O3+ |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-(2-methyl-3-propylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
| SMILES | CCC[n+]1ccn(CCOC(=O)[C@](O)(c2ccccc2)[C@H]2CCC(F)(F)C2)c1C |
| InChI | InChI=1S/C22H29F2N2O3/c1-3-11-25-12-13-26(17(25)2)14-15-29-20(27)22(28,18-7-5-4-6-8-18)19-9-10-21(23,24)16-19/h4-8,12-13,19,28H,3,9-11,14-16H2,1-2H3/q+1/t19-,22-/m0/s1 |
| InChIKey | IRSUBVZRLQZCDJ-UGKGYDQZSA-N |
| XLogP | 3.36 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|