C20H24F2N2O3 — CID 24753355
3-(2-methylimidazol-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate (PubChem CID 24753355) has the molecular formula C20H24F2N2O3 and a molecular weight of 378.42 g/mol. Its IUPAC name is 3-(2-methylimidazol-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate.
| Compound Name | 3-(2-methylimidazol-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 24753355 |
| Molecular Formula | C20H24F2N2O3 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-(2-methylimidazol-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
| SMILES | Cc1nccn1CCCOC(=O)[C@](O)(c1ccccc1)[C@@H]1CCC(F)(F)C1 |
| InChI | InChI=1S/C20H24F2N2O3/c1-15-23-10-12-24(15)11-5-13-27-18(25)20(26,16-6-3-2-4-7-16)17-8-9-19(21,22)14-17/h2-4,6-7,10,12,17,26H,5,8-9,11,13-14H2,1H3/t17-,20+/m1/s1 |
| InChIKey | WDGNDYLCTUZSGD-XLIONFOSSA-N |
| XLogP | 3.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|