C26H29F2N2O3+ — CID 24753544
2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate (PubChem CID 24753544) has the molecular formula C26H29F2N2O3+ and a molecular weight of 455.53 g/mol. Its IUPAC name is 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate.
| Compound Name | 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 24753544 |
| Molecular Formula | C26H29F2N2O3+ |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
| SMILES | Cc1n(CCOC(=O)[C@](O)(c2ccccc2)[C@@H]2CCC(F)(F)C2)cc[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C26H29F2N2O3/c1-20-29(14-15-30(20)19-21-8-4-2-5-9-21)16-17-33-24(31)26(32,22-10-6-3-7-11-22)23-12-13-25(27,28)18-23/h2-11,14-15,23,32H,12-13,16-19H2,1H3/q+1/t23-,26+/m1/s1 |
| InChIKey | DTHAKFKQQZMAHN-BVAGGSTKSA-N |
| XLogP | 4.00 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|