C15H27N — CID 25003832
4-methyl-6-(2,2,3-trimethylcyclopentyl)hexanenitrile (PubChem CID 25003832) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 4-methyl-6-(2,2,3-trimethylcyclopentyl)hexanenitrile.
| Compound Name | 4-methyl-6-(2,2,3-trimethylcyclopentyl)hexanenitrile |
|---|---|
| PubChem CID | 25003832 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 4-methyl-6-(2,2,3-trimethylcyclopentyl)hexanenitrile |
| SMILES | CC(CCC#N)CCC1CCC(C)C1(C)C |
| InChI | InChI=1S/C15H27N/c1-12(6-5-11-16)7-9-14-10-8-13(2)15(14,3)4/h12-14H,5-10H2,1-4H3 |
| InChIKey | HOBBOUYJWZCYSG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |