C14H24N2 — CID 15834352
2,3-dimethyl-2,3-bis(2-methylpropyl)butanedinitrile (PubChem CID 15834352) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2,3-dimethyl-2,3-bis(2-methylpropyl)butanedinitrile.
| Compound Name | 2,3-dimethyl-2,3-bis(2-methylpropyl)butanedinitrile |
|---|---|
| PubChem CID | 15834352 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2,3-dimethyl-2,3-bis(2-methylpropyl)butanedinitrile |
| SMILES | CC(C)CC(C)(C#N)C(C)(C#N)CC(C)C |
| InChI | InChI=1S/C14H24N2/c1-11(2)7-13(5,9-15)14(6,10-16)8-12(3)4/h11-12H,7-8H2,1-6H3 |
| InChIKey | ZSQZMKLXZYSHCK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |