C18H25ClN4O5 — CID 25003874
(2S)-5-amino-2-[[(2R)-2-[(2-amino-5-chlorobenzoyl)amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid (PubChem CID 25003874) has the molecular formula C18H25ClN4O5 and a molecular weight of 412.87 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2R)-2-[(2-amino-5-chlorobenzoyl)amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2R)-2-[(2-amino-5-chlorobenzoyl)amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 25003874 |
| Molecular Formula | C18H25ClN4O5 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (2S)-5-amino-2-[[(2R)-2-[(2-amino-5-chlorobenzoyl)amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)c1cc(Cl)ccc1N)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C18H25ClN4O5/c1-9(2)7-14(17(26)22-13(18(27)28)5-6-15(21)24)23-16(25)11-8-10(19)3-4-12(11)20/h3-4,8-9,13-14H,5-7,20H2,1-2H3,(H2,21,24)(H,22,26)(H,23,25)(H,27,28)/t13-,14+/m0/s1 |
| InChIKey | NZLFLOKDVZMJAI-UONOGXRCSA-N |
| XLogP | 0.90 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|